3-(Diethylcarbamoyl)-4-fluorophenylboronic acid

CAS

874219-28-0

Catalog Number

ACM874219280

Category

Other Products; Boronic Acids

Molecular Weight

239.05

Molecular Formula

C₁₁H₁₅BFNO₃

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

May 23, 2023

Very useful in optical experiments.
3-(Diethylcarbamoyl)-4-fluorophenylboronic acid is a light-stable ultraviolet absorber, which is not easy to decompose.

What is the molecular formula of the compound?

The molecular formula of the compound is C11H15BFNO3.

What are some synonyms for the compound?

Some synonyms for the compound are 874219-28-0, 3-(Diethylcarbamoyl)-4-fluorophenylboronic acid, (3-(Diethylcarbamoyl)-4-fluorophenyl)boronic acid, and 3-(Diethylcarbamoyl)-4-fluorobenzeneboronic acid.

What is the molecular weight of the compound?

The molecular weight of the compound is 239.05 g/mol.

When was the compound created and last modified?

The compound was created on March 14, 2010, and last modified on December 2, 2023.

What is the IUPAC name of the compound?

The IUPAC name of the compound is [3-(diethylcarbamoyl)-4-fluorophenyl]boronic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C11H15BFNO3/c1-3-14(4-2)11(15)9-7-8(12(16)17)5-6-10(9)13/h5-7,16-17H,3-4H2,1-2H3.

What is the InChIKey of the compound?

The InChIKey of the compound is CINQYDGBDNUJIH-UHFFFAOYSA-N.

What is the canonical SMILES representation of the compound?

The canonical SMILES representation of the compound is B(C1=CC(=C(C=C1)F)C(=O)N(CC)CC)(O)O.