5-(Dimethylcarbamoyl)-3-fluorophenylboronic acid

CAS

874219-39-3

Catalog Number

ACM874219393

Category

Other Products; Boronic Acids

Molecular Weight

211

Molecular Formula

C9H11BFNO3

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

May 23, 2023

High efficient catalyst.
5-(Dimethylcarbamoyl)-3-fluorophenylboronic acid can catalyze the synthesis of endothelin receptor antagonists

What is the molecular formula of 5-(Dimethylcarbamoyl)-3-fluorophenylboronic acid?

The molecular formula is C9H11BFNO3.

What is the chemical structure of 5-(Dimethylcarbamoyl)-3-fluorophenylboronic acid?

The chemical structure is not provided in the reference.

What are the synonyms for 5-(Dimethylcarbamoyl)-3-fluorophenylboronic acid?

The synonyms are 874219-39-3, (3-(Dimethylcarbamoyl)-5-fluorophenyl)boronic acid, [3-(dimethylcarbamoyl)-5-fluorophenyl]boronic acid, and (3-(Dimethylcarbamoyl)-5-fluorophenyl)boronic acid.

What is the molecular weight of 5-(Dimethylcarbamoyl)-3-fluorophenylboronic acid?

The molecular weight is 211.00 g/mol.

What is the IUPAC name of 5-(Dimethylcarbamoyl)-3-fluorophenylboronic acid?

The IUPAC name is [3-(dimethylcarbamoyl)-5-fluorophenyl]boronic acid.

What is the InChI of 5-(Dimethylcarbamoyl)-3-fluorophenylboronic acid?

The InChI is InChI=1S/C9H11BFNO3/c1-12(2)9(13)6-3-7(10(14)15)5-8(11)4-6/h3-5,14-15H,1-2H3.

What is the InChIKey of 5-(Dimethylcarbamoyl)-3-fluorophenylboronic acid?

The InChIKey is PSLVFPXQNCQCCY-UHFFFAOYSA-N.

What is the canonical SMILES of 5-(Dimethylcarbamoyl)-3-fluorophenylboronic acid?

The canonical SMILES is B(C1=CC(=CC(=C1)F)C(=O)N(C)C)(O)O.

What is the CAS number of 5-(Dimethylcarbamoyl)-3-fluorophenylboronic acid?

The CAS number is 874219-39-3.

What is the molecular weight, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoisotopic mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, undefined bond stereocenter count, covalently-bonded unit count, and compound canonicalization of 5-(Dimethylcarbamoyl)-3-fluorophenylboronic acid?

The molecular weight is 211.00 g/mol.
The hydrogen bond donor count is 2.
The hydrogen bond acceptor count is 4.
The rotatable bond count is 2.
The exact mass is 211.0816015 g/mol.
The monoisotopic mass is 211.0816015 g/mol.
The topological polar surface area is 60.8Å².
The heavy atom count is 15.
The formal charge is 0.
The complexity is 237.
The isotope atom count is 0.
The defined atom stereocenter count is 0.
The undefined atom stereocenter count is 0.
The defined bond stereocenter count is 0.
The undefined bond stereocenter count is 0.
The covalently-bonded unit count is 1.
The compound is canonicalized.