What is the molecular formula of 2,6-Difluoro-4-hydroxybenzeneboronic acid?
The molecular formula is C6H5BF2O3.
When was 2,6-Difluoro-4-hydroxybenzeneboronic acid created?
It was created on June 22, 2010.
What is the IUPAC name of 2,6-Difluoro-4-hydroxybenzeneboronic acid?
The IUPAC name is (2,6-difluoro-4-hydroxyphenyl)boronic acid.
What is the InChI of 2,6-Difluoro-4-hydroxybenzeneboronic acid?
The InChI is InChI=1S/C6H5BF2O3/c8-4-1-3(10)2-5(9)6(4)7(11)12/h1-2,10-12H.
What is the InChIKey of 2,6-Difluoro-4-hydroxybenzeneboronic acid?
The InChIKey is JPAMLWIQHDPWGK-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Difluoro-4-hydroxybenzeneboronic acid?
The canonical SMILES is B(C1=C(C=C(C=C1F)O)F)(O)O.
What is the CAS number of 2,6-Difluoro-4-hydroxybenzeneboronic acid?
The CAS number is 957065-87-1.
What is the molecular weight of 2,6-Difluoro-4-hydroxybenzeneboronic acid?
The molecular weight is 173.91 g/mol.
How many hydrogen bond donor counts are there in 2,6-Difluoro-4-hydroxybenzeneboronic acid?
There are 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in 2,6-Difluoro-4-hydroxybenzeneboronic acid?
There are 5 hydrogen bond acceptor counts.