2-Amino-5-bromo-3-nitro-4-picoline

• CAS: 100367-40-6
• Catalog Number: ACM100367406
• Category: Bromine Series
• Molecular Weight: 232.03
• Molecular Formula: C₆H₆BrN₃O₂

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C6H6BrN3O2.

What is the molecular weight of the compound?

The molecular weight of the compound is 232.03 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 5-bromo-4-methyl-3-nitropyridin-2-amine.

What is the InChI code of the compound?

The InChI code of the compound is InChI=1S/C6H6BrN3O2/c1-3-4(7)2-9-6(8)5(3)10(11)12/h2H,1H3,(H2,8,9).

What is the InChIKey of the compound?

The InChIKey of the compound is KFVGEPWMVKZPND-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC1=C(C(=NC=C1Br)N)[N+](=O)[O-].

What is the CAS number of the compound?

The CAS number of the compound is 100367-40-6.

What is the EC number of the compound?

The EC number of the compound is 634-469-3.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.9.

Is the compound a canonicalized form?

Yes, the compound is canonicalized.