Ethyl 2-bromothiazole-4-carboxylate

• CAS: 100367-77-9
• Catalog Number: ACM100367779
• Category: Bromine Series
• Molecular Weight: 236.09
• Molecular Formula: C₆H₆BrNO₂S

Custom Q&A

What is the molecular formula of Ethyl 2-bromothiazole-4-carboxylate?

The molecular formula is C6H6BrNO2S.

What is the IUPAC name of Ethyl 2-bromothiazole-4-carboxylate?

The IUPAC name is ethyl 2-bromo-1,3-thiazole-4-carboxylate.

What is the InChI of Ethyl 2-bromothiazole-4-carboxylate?

The InChI is InChI=1S/C6H6BrNO2S/c1-2-10-5(9)4-3-11-6(7)8-4/h3H,2H2,1H3.

What is the InChIKey of Ethyl 2-bromothiazole-4-carboxylate?

The InChIKey is CNHISCQPKKGDPO-UHFFFAOYSA-N.

What is the canonical SMILES of Ethyl 2-bromothiazole-4-carboxylate?

The canonical SMILES is CCOC(=O)C1=CSC(=N1)Br.

What is the CAS number of Ethyl 2-bromothiazole-4-carboxylate?

The CAS number is 100367-77-9.

What is the molecular weight of Ethyl 2-bromothiazole-4-carboxylate?

The molecular weight is 236.09 g/mol.

What is the XLogP3-AA value of Ethyl 2-bromothiazole-4-carboxylate?

The XLogP3-AA value is 2.5.

How many hydrogen bond donor counts does Ethyl 2-bromothiazole-4-carboxylate have?

Ethyl 2-bromothiazole-4-carboxylate has 0 hydrogen bond donor count.

How many rotatable bond counts does Ethyl 2-bromothiazole-4-carboxylate have?

Ethyl 2-bromothiazole-4-carboxylate has 3 rotatable bond counts.