4,5-Dibromo-1-methyl-1H-imidazole

• CAS: 1003-50-5
• Catalog Number: ACM1003505
• Category: Bromine Series
• Molecular Weight: 239.90
• Molecular Formula: C₄H₄Br₂N₂

Custom Q&A

What is the molecular formula of 4,5-Dibromo-1-methyl-1H-imidazole?

The molecular formula is C4H4Br2N2.

What is the molecular weight of 4,5-Dibromo-1-methyl-1H-imidazole?

The molecular weight is 239.90 g/mol.

What is the IUPAC name of 4,5-Dibromo-1-methyl-1H-imidazole?

The IUPAC name is 4,5-dibromo-1-methylimidazole.

What is the InChI of 4,5-Dibromo-1-methyl-1H-imidazole?

The InChI is InChI=1S/C4H4Br2N2/c1-8-2-7-3(5)4(8)6/h2H,1H3.

What is the InChIKey of 4,5-Dibromo-1-methyl-1H-imidazole?

The InChIKey is JGFCQTKCCPQLKP-UHFFFAOYSA-N.

What is the CAS number of 4,5-Dibromo-1-methyl-1H-imidazole?

The CAS number is 1003-50-5.

How many hydrogen bond donor counts does 4,5-Dibromo-1-methyl-1H-imidazole have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 4,5-Dibromo-1-methyl-1H-imidazole have?

It has 1 hydrogen bond acceptor count.

What is the topological polar surface area of 4,5-Dibromo-1-methyl-1H-imidazole?

The topological polar surface area is 17.8Ų.

Is 4,5-Dibromo-1-methyl-1H-imidazole a canonicalized compound?

Yes, it is a canonicalized compound.