CAS
--- Purity
---
--- Purity
---
Inquiry Basket
Octafluoroadipoyl chloride
Catalog Number
ACMA00001485
Category
Amines
Molecular Weight
326.96
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H315-H319-H335
RIDADR
UN 3265 8 / PGII
Symbol
GHS07
What is the PubChem CID of Octafluoroadipoyl chloride?
The PubChem CID of Octafluoroadipoyl chloride is 2775843.
What is the molecular formula of Octafluoroadipoyl chloride?
The molecular formula of Octafluoroadipoyl chloride is C6Cl2F8O2.
What is the molecular weight of Octafluoroadipoyl chloride?
The molecular weight of Octafluoroadipoyl chloride is 326.95 g/mol.
What is the IUPAC name of Octafluoroadipoyl chloride?
The IUPAC name of Octafluoroadipoyl chloride is 2,2,3,3,4,4,5,5-octafluorohexanedioyl dichloride.
What is the InChI of Octafluoroadipoyl chloride?
The InChI of Octafluoroadipoyl chloride is InChI=1S/C6Cl2F8O2/c7-1(17)3(9,10)5(13,14)6(15,16)4(11,12)2(8)18.
What is the InChIKey of Octafluoroadipoyl chloride?
The InChIKey of Octafluoroadipoyl chloride is NGSYNEZFBAPQFK-UHFFFAOYSA-N.
What is the canonical SMILES of Octafluoroadipoyl chloride?
The canonical SMILES of Octafluoroadipoyl chloride is C(=O)(C(C(C(C(C(=O)Cl)(F)F)(F)F)(F)F)(F)F)Cl.
What is the CAS number of Octafluoroadipoyl chloride?
The CAS number of Octafluoroadipoyl chloride is 336-06-1.
What is the European Community (EC) number of Octafluoroadipoyl chloride?
The European Community (EC) number of Octafluoroadipoyl chloride is 689-079-6.
Is Octafluoroadipoyl chloride canonicalized in PubChem?
Yes, Octafluoroadipoyl chloride is canonicalized in PubChem.
Recommended Products
