CAS
--- Purity
---
--- Purity
---
Inquiry Basket
2-Carboxy phenylsulfamide
Catalog Number
ACMA00001482
Category
Amines
Molecular Weight
201.20
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H319
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of 2-Carboxy phenylsulfamide?
The molecular formula of 2-Carboxy phenylsulfamide is C7H7NO4S.
What is the molecular weight of 2-Carboxy phenylsulfamide?
The molecular weight of 2-Carboxy phenylsulfamide is 201.20 g/mol.
What is the CAS number of 2-Carboxy phenylsulfamide?
The CAS number of 2-Carboxy phenylsulfamide is 632-24-6.
What is the IUPAC name of 2-Carboxy phenylsulfamide?
The IUPAC name of 2-Carboxy phenylsulfamide is 2-sulfamoylbenzoic acid.
What is the canonical SMILES of 2-Carboxy phenylsulfamide?
The canonical SMILES of 2-Carboxy phenylsulfamide is C1=CC=C(C(=C1)C(=O)O)S(=O)(=O)N.
What is the InChI of 2-Carboxy phenylsulfamide?
The InChI of 2-Carboxy phenylsulfamide is InChI=1S/C7H7NO4S/c8-13(11,12)6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10)(H2,8,11,12).
How many hydrogen bond donor counts does 2-Carboxy phenylsulfamide have?
2-Carboxy phenylsulfamide has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Carboxy phenylsulfamide have?
2-Carboxy phenylsulfamide has 5 hydrogen bond acceptor counts.
What is the topological polar surface area of 2-Carboxy phenylsulfamide?
The topological polar surface area of 2-Carboxy phenylsulfamide is 106Ų.
How many rotatable bond counts does 2-Carboxy phenylsulfamide have?
2-Carboxy phenylsulfamide has 2 rotatable bond counts.
Recommended Products
