Fmoc-(4-aminophenyl)acetic acid

• Catalog Number: ACMA00002681
• Category: Ethers
• Molecular Weight: 373.40
• Molecular Formula: C₂₂H₁₆N₂O₂
• Hazard Statements: H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of Fmoc-(4-aminophenyl)acetic acid?

The molecular formula of Fmoc-(4-aminophenyl)acetic acid is C23H19NO4.

What is the molecular weight of Fmoc-(4-aminophenyl)acetic acid?

The molecular weight of Fmoc-(4-aminophenyl)acetic acid is 373.4 g/mol.

What is the IUPAC name of Fmoc-(4-aminophenyl)acetic acid?

The IUPAC name of Fmoc-(4-aminophenyl)acetic acid is 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]acetic acid.

What is the InChI of Fmoc-(4-aminophenyl)acetic acid?

The InChI of Fmoc-(4-aminophenyl)acetic acid is InChI=1S/C23H19NO4/c25-22(26)13-15-9-11-16(12-10-15)24-23(27)28-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21H,13-14H2,(H,24,27)(H,25,26).

What is the InChIKey of Fmoc-(4-aminophenyl)acetic acid?

The InChIKey of Fmoc-(4-aminophenyl)acetic acid is YRZJNRXNEUSRLW-UHFFFAOYSA-N.

What is the canonical SMILES of Fmoc-(4-aminophenyl)acetic acid?

The canonical SMILES of Fmoc-(4-aminophenyl)acetic acid is C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)CC(=O)O.

What is the CAS number of Fmoc-(4-aminophenyl)acetic acid?

The CAS number of Fmoc-(4-aminophenyl)acetic acid is 173690-53-4.

What is the XLogP3-AA value of Fmoc-(4-aminophenyl)acetic acid?

The XLogP3-AA value of Fmoc-(4-aminophenyl)acetic acid is 4.1.

How many hydrogen bond donor counts are there in Fmoc-(4-aminophenyl)acetic acid?

There are 2 hydrogen bond donor counts in Fmoc-(4-aminophenyl)acetic acid.

How many hydrogen bond acceptor counts are there in Fmoc-(4-aminophenyl)acetic acid?

There are 4 hydrogen bond acceptor counts in Fmoc-(4-aminophenyl)acetic acid.