[(1S,3S,4S)-4-Amino-3-hydroxy-5-phenyl-1-(phenylmethyl)pentyl]-carbamic acid 1,1-dimethylethyl ester

• Catalog Number: ACMA00002679
• Category: Ethers
• Molecular Weight: 384.51
• Molecular Formula: C₂₂H₁₆N₂O₂
• Hazard Statements: H315-H318-H335-H410
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS05

Custom Q&A

What is the molecular formula of the compound in PubChem CID 11997926?

The molecular formula is C23H32N2O3.

What is the molecular weight of the compound?

The molecular weight is 384.5 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is tert-butyl N-[(2S,4S,5S)-5-amino-4-hydroxy-1,6-diphenylhexan-2-yl]carbamate.

What is the Canonical SMILES of the compound?

The Canonical SMILES is CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)CC(C(CC2=CC=CC=C2)N)O.

How many hydrogen bond donor counts does the compound have?

The compound has 3 hydrogen bond donor counts.

What is the topological polar surface area of the compound?

The topological polar surface area is 84.6 Ų.

What is the exact mass of the compound?

The exact mass is 384.24129289 g/mol.

How many rotatable bond counts does the compound have?

The compound has 10 rotatable bond counts.

What is the InChIKey of the compound?

The InChIKey is UKFHOTNATOJBKZ-ACRUOGEOSA-N.

What is the CAS number of the compound?

The CAS number is 144163-85-9.