Ethyl 5-chloro-2-methoxybenzoylformate

• Catalog Number: ACMA00002200
• Category: Ethers
• Molecular Weight: 242.66
• Molecular Formula: C₁₁H₁₀O₂
• Hazard Statements: H319-H411
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of Ethyl 5-chloro-2-methoxybenzoylformate?

The molecular formula of Ethyl 5-chloro-2-methoxybenzoylformate is C11H11ClO4.

What is the IUPAC name of Ethyl 5-chloro-2-methoxybenzoylformate?

The IUPAC name of Ethyl 5-chloro-2-methoxybenzoylformate is ethyl 2-(5-chloro-2-methoxyphenyl)-2-oxoacetate.

What is the InChI code of Ethyl 5-chloro-2-methoxybenzoylformate?

The InChI code of Ethyl 5-chloro-2-methoxybenzoylformate is InChI=1S/C11H11ClO4/c1-3-16-11(14)10(13)8-6-7(12)4-5-9(8)15-2/h4-6H,3H2,1-2H3.

What is the InChIKey of Ethyl 5-chloro-2-methoxybenzoylformate?

The InChIKey of Ethyl 5-chloro-2-methoxybenzoylformate is TYJGCFNKZHJLMB-UHFFFAOYSA-N.

What is the canonical SMILES of Ethyl 5-chloro-2-methoxybenzoylformate?

The canonical SMILES of Ethyl 5-chloro-2-methoxybenzoylformate is CCOC(=O)C(=O)C1=C(C=CC(=C1)Cl)OC.

What is the molecular weight of Ethyl 5-chloro-2-methoxybenzoylformate?

The molecular weight of Ethyl 5-chloro-2-methoxybenzoylformate is 242.65 g/mol.

What is the XLogP3-AA value of Ethyl 5-chloro-2-methoxybenzoylformate?

The XLogP3-AA value of Ethyl 5-chloro-2-methoxybenzoylformate is 2.6.

How many hydrogen bond donor counts does Ethyl 5-chloro-2-methoxybenzoylformate have?

Ethyl 5-chloro-2-methoxybenzoylformate has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Ethyl 5-chloro-2-methoxybenzoylformate have?

Ethyl 5-chloro-2-methoxybenzoylformate has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does Ethyl 5-chloro-2-methoxybenzoylformate have?

Ethyl 5-chloro-2-methoxybenzoylformate has 5 rotatable bond counts.