1-(4-Chlorophenyl)-3-hydroxycyclobutanecarboxylic acid

• Catalog Number: ACMA00002199
• Category: Ethers
• Molecular Weight: 226.66
• Molecular Formula: C₁₁H₁₁BrO₃
• Hazard Statements: H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C11H11ClO3.

What are the synonyms of the compound?

The synonyms of the compound are 1-(4-CHLOROPHENYL)-3-HYDROXYCYCLOBUTANECARBOXYLIC ACID, 1145681-01-1, 1353636-65-3, and 933469-83-1.

What is the molecular weight of the compound?

The molecular weight of the compound is 226.65 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 1-(4-chlorophenyl)-3-hydroxycyclobutane-1-carboxylic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C11H11ClO3/c12-8-3-1-7(2-4-8)11(10(14)15)5-9(13)6-11/h1-4,9,13H,5-6H2,(H,14,15).

What is the InChIKey of the compound?

The InChIKey of the compound is PQVUQOBVSQOFKH-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1C(CC1(C2=CC=C(C=C2)Cl)C(=O)O).

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.7.

How many hydrogen bond donor counts does the compound have?

The compound has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.