Dimethylaminoacetyl chloride hydrochloride

• Catalog Number: ACMA00001274
• Category: Amines
• Molecular Weight: 158.03
• Molecular Formula: C₄H₄N₂OS
• Hazard Statements: H302-H317
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of Dimethylaminoacetyl chloride hydrochloride?

The molecular formula is C4H9Cl2NO.

What is the molecular weight of Dimethylaminoacetyl chloride hydrochloride?

The molecular weight is 158.02 g/mol.

What is the IUPAC name of Dimethylaminoacetyl chloride hydrochloride?

The IUPAC name is 2-(dimethylamino)acetyl chloride;hydrochloride.

What is the InChI of Dimethylaminoacetyl chloride hydrochloride?

The InChI is InChI=1S/C4H8ClNO.ClH/c1-6(2)3-4(5)7;/h3H2,1-2H3;1H.

What is the InChIKey of Dimethylaminoacetyl chloride hydrochloride?

The InChIKey is MVAXDKDOPWPFML-UHFFFAOYSA-N.

What is the canonical SMILES of Dimethylaminoacetyl chloride hydrochloride?

The canonical SMILES is CN(C)CC(=O)Cl.Cl.

What is the CAS number of Dimethylaminoacetyl chloride hydrochloride?

The CAS number is 60853-81-8.

What is the European Community (EC) number of Dimethylaminoacetyl chloride hydrochloride?

The EC number is 679-225-7.

What is the hydrogen bond donor count of Dimethylaminoacetyl chloride hydrochloride?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of Dimethylaminoacetyl chloride hydrochloride?

The hydrogen bond acceptor count is 2.