(Dimethylamino)(3-fluorophenyl)acetic acid hydrochloride

• Catalog Number: ACMA00000980
• Category: Amines
• Molecular Weight: 233.67
• Molecular Formula: C₁₁H₉NO₂
• Hazard Statements: H302-H317-H319-H411
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (Dimethylamino)(3-fluorophenyl)acetic acid hydrochloride?

The molecular formula is C10H13ClFNO2.

What is the PubChem CID of (Dimethylamino)(3-fluorophenyl)acetic acid hydrochloride?

The PubChem CID is 45595313.

What is the molecular weight of (Dimethylamino)(3-fluorophenyl)acetic acid hydrochloride?

The molecular weight is 233.67 g/mol.

What is the parent compound of (Dimethylamino)(3-fluorophenyl)acetic acid hydrochloride?

The parent compound is CID 43803168 (2-(Dimethylamino)-2-(3-fluorophenyl)acetic acid).

What are the component compounds of (Dimethylamino)(3-fluorophenyl)acetic acid hydrochloride?

The component compounds are CID 43803168 (2-(Dimethylamino)-2-(3-fluorophenyl)acetic acid) and CID 313 (Hydrochloric Acid).

What is the IUPAC name of (Dimethylamino)(3-fluorophenyl)acetic acid hydrochloride?

The IUPAC name is 2-(dimethylamino)-2-(3-fluorophenyl)acetic acid;hydrochloride.

What is the InChI of (Dimethylamino)(3-fluorophenyl)acetic acid hydrochloride?

The InChI is InChI=1S/C10H12FNO2.ClH/c1-12(2)9(10(13)14)7-4-3-5-8(11)6-7;/h3-6,9H,1-2H3,(H,13,14);1H.

What is the InChIKey of (Dimethylamino)(3-fluorophenyl)acetic acid hydrochloride?

The InChIKey is OCTKRZXORYYRHO-UHFFFAOYSA-N.

What is the canonical SMILES of (Dimethylamino)(3-fluorophenyl)acetic acid hydrochloride?

The canonical SMILES is CN(C)C(C1=CC(=CC=C1)F)C(=O)O.Cl.

Is the compound canonicalized?

Yes, the compound is canonicalized.