--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H11FO.
The molecular weight of the compound is 166.19 g/mol.
The IUPAC name of the compound is 1-(4-fluorophenyl)-2-methylpropan-1-one.
The CAS number of the compound is 26393-91-9.
The InChIKey of the compound is MHUVRVXSYXJUPK-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(C)C(=O)C1=CC=C(C=C1)F.
The XLogP3 value of the compound is 2.8.
There are 0 hydrogen bond donor atoms present in the compound.
There are 2 hydrogen bond acceptor atoms present in the compound.
There are 2 rotatable bonds present in the compound.