What is the molecular formula of Methyl 6-amino-thieno[3,2-b]pyridine-3-carboxylate?
The molecular formula is C9H8N2O2S.
What is the molecular weight of Methyl 6-amino-thieno[3,2-b]pyridine-3-carboxylate?
The molecular weight is 208.24 g/mol.
What are some synonyms for Methyl 6-amino-thieno[3,2-b]pyridine-3-carboxylate?
Some synonyms include METHYL 6-AMINO-THIENO[3,2-B]PYRIDINE-3-CARBOXYLATE and DTXSID60662729.
When was Methyl 6-amino-thieno[3,2-b]pyridine-3-carboxylate created and modified in PubChem?
It was created on 2010-03-29 and modified on 2023-12-30.
What is the IUPAC name of Methyl 6-amino-thieno[3,2-b]pyridine-3-carboxylate?
The IUPAC name is methyl 6-aminothieno[3,2-b]pyridine-3-carboxylate.
What is the InChIKey of Methyl 6-amino-thieno[3,2-b]pyridine-3-carboxylate?
The InChIKey is ZFRJHRVOWBSEBS-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Methyl 6-amino-thieno[3,2-b]pyridine-3-carboxylate?
The Canonical SMILES is COC(=O)C1=CSC2=C1N=CC(=C2)N.
How many Hydrogen Bond Donor Count does Methyl 6-amino-thieno[3,2-b]pyridine-3-carboxylate have?
It has 1 Hydrogen Bond Donor Count.
What is the Heavy Atom Count of Methyl 6-amino-thieno[3,2-b]pyridine-3-carboxylate?
The Heavy Atom Count is 14.
Is the Compound Is Canonicalized for Methyl 6-amino-thieno[3,2-b]pyridine-3-carboxylate?
Yes, the Compound Is Canonicalized.