959245-38-6 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C14H18BrNO2S.
The molecular weight of the compound is 344.27 g/mol.
The IUPAC name of the compound is tert-butyl 3-(3-bromophenyl)sulfanylazetidine-1-carboxylate.
The InChI of the compound is InChI=1S/C14H18BrNO2S/c1-14(2,3)18-13(17)16-8-12(9-16)19-11-6-4-5-10(15)7-11/h4-7,12H,8-9H2,1-3H3.
The InChIKey of the compound is XPQDPMFUBASWFD-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CC(C)(C)OC(=O)N1CC(C1)SC2=CC(=CC=C2)Br.
The XLogP3-AA value of the compound is 3.8.
The compound has 0 hydrogen bond donor counts.
The compound has 3 hydrogen bond acceptor counts.
The compound has 4 rotatable bond counts.