What is the molecular formula of Methyl 6-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate?
The molecular formula is C9H7ClN2O2.
What is the molecular weight of Methyl 6-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate?
The molecular weight is 210.62 g/mol.
What is the IUPAC Name of Methyl 6-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate?
The IUPAC Name is methyl 6-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate.
What is the InChI of Methyl 6-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate?
The InChI is InChI=1S/C9H7ClN2O2/c1-14-9(13)6-4-11-7-2-5(10)3-12-8(6)7/h2-4,11H,1H3.
What is the InChIKey of Methyl 6-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate?
The InChIKey is RESWVHCNJSPUGN-UHFFFAOYSA-N.
What is the Canonical SMILES of Methyl 6-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate?
The Canonical SMILES is COC(=O)C1=CNC2=C1N=CC(=C2)Cl.
What is the CAS number of Methyl 6-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate?
The CAS number is 959245-12-6.
How many hydrogen bond donor counts does Methyl 6-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate have?
It has 1 hydrogen bond donor count.
What is the XLogP3-AA value of Methyl 6-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate?
The XLogP3-AA value is 1.5.
Is the compound canonicalized?
Yes, the compound is canonicalized.