959239-18-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H18N2.
The IUPAC name of the compound is 3,3-dimethyl-1-pyridin-3-ylbutan-1-amine.
The InChI of the compound is InChI=1S/C11H18N2/c1-11(2,3)7-10(12)9-5-4-6-13-8-9/h4-6,8,10H,7,12H2,1-3H3.
The InChIKey of the compound is VLKDKWYBQJERMT-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(C)(C)CC(C1=CN=CC=C1)N.
The molecular weight of the compound is 178.27 g/mol.
The XLogP3-AA value of the compound is 1.8.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The compound has 3 rotatable bond counts.