959239-30-6 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C6H12N4.
The molecular weight of the compound is 140.19 g/mol.
The IUPAC name of the compound is 1-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine.
The InChI of the compound is InChI=1S/C6H12N4/c1-3-5(7)6-8-4-9-10(6)2/h4-5H,3,7H2,1-2H3.
The InChIKey of the compound is SGXWUDGJVDSLSF-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCC(C1=NC=NN1C)N.
The CAS number of the compound is 959239-47-5.
The XLogP3-AA value of the compound is -0.2.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.