What is the molecular formula of trans-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The molecular formula is C7H14ClNO2.
What are the synonyms for trans-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The synonyms include cis-Ethyl 3-aminocyclobutanecarboxylate hydrochloride, cis-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride, and more.
What is the molecular weight of trans-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The molecular weight is 179.64 g/mol.
What is the parent compound of trans-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The parent compound is Ethyl 3-aminocyclobutanecarboxylate, with CID 46224517.
What are the component compounds of trans-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The component compounds are Ethyl 3-aminocyclobutanecarboxylate (CID 46224517) and Hydrochloric Acid (CID 313).
When was trans-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride created?
It was created on August 8, 2011.
When was trans-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of trans-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The IUPAC name is ethyl 3-aminocyclobutane-1-carboxylate;hydrochloride.
What is the InChI of trans-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The InChI is InChI=1S/C7H13NO2.ClH/c1-2-10-7(9)5-3-6(8)4-5;/h5-6H,2-4,8H2,1H3;1H.
What is the Canonical SMILES of trans-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The Canonical SMILES is CCOC(=O)C1CC(C1)N.Cl.