CAS
957793-35-0 Purity
---
957793-35-0 Purity
---
Shopping basket
trans-3-Aminocyclobutanecarboxylic acid ethyl ester
CAS
957793-97-4
Catalog Number
ACM957793974
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is ethyl 3-aminocyclobutane-1-carboxylate.
What is the molecular formula of the compound?
The molecular formula of the compound is C7H13NO2.
What is the molecular weight of the compound?
The molecular weight of the compound is 143.18 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H13NO2/c1-2-10-7(9)5-3-6(8)4-5/h5-6H,2-4,8H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is RLWYQPWCTNGHEF-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCOC(=O)C1CC(C1)N.
What is the CAS number of the compound?
The CAS number of the compound is 74307-73-6.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.1.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
Recommended Products
CAS
957793-36-1 Purity
96%
957793-36-1 Purity
96%
