What is the molecular formula of cis-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The molecular formula is C7H14ClNO2.
How is the molecular weight of cis-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride computed?
The molecular weight is computed by PubChem 2.1.
What is the parent compound of cis-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The parent compound is CID 46224517 (Ethyl 3-aminocyclobutanecarboxylate).
What are the synonyms of cis-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The synonyms are 957793-35-0, cis-Ethyl 3-aminocyclobutanecarboxylate hydrochloride, cis-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride, 1375303-78-8, 957793-36-1.
When was cis-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride created?
It was created on August 8, 2011.
When was cis-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of cis-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The IUPAC name is ethyl 3-aminocyclobutane-1-carboxylate;hydrochloride.
What is the InChI of cis-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The InChI is InChI=1S/C7H13NO2.ClH/c1-2-10-7(9)5-3-6(8)4-5;/h5-6H,2-4,8H2,1H3;1H.
What is the InChIKey of cis-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The InChIKey is JEJWYGQWKNHONY-UHFFFAOYSA-N.
What is the canonical SMILES of cis-3-Aminocyclobutanecarboxylic acid ethyl ester hydrochloride?
The canonical SMILES is CCOC(=O)C1CC(C1)N.Cl.