What is the molecular formula of 5,7-Dichloroquinoline-2,3-dicarboxylic acid diethyl ester?
The molecular formula is C15H13Cl2NO4.
What are some synonyms for 5,7-Dichloroquinoline-2,3-dicarboxylic acid diethyl ester?
Some synonyms include diethyl 5,7-dichloroquinoline-2,3-dicarboxylate and AB52185.
When was 5,7-Dichloroquinoline-2,3-dicarboxylic acid diethyl ester created and modified in PubChem?
It was created on 2007-11-13 and modified on 2023-12-30.
What is the InChIKey of 5,7-Dichloroquinoline-2,3-dicarboxylic acid diethyl ester?
The InChIKey is CECRYKISFOHKKT-UHFFFAOYSA-N.
What is the Canonical SMILES for 5,7-Dichloroquinoline-2,3-dicarboxylic acid diethyl ester?
The Canonical SMILES is CCOC(=O)C1=C(N=C2C=C(C=C(C2=C1)Cl)Cl)C(=O)OCC.
What is the topological polar surface area of 5,7-Dichloroquinoline-2,3-dicarboxylic acid diethyl ester?
The topological polar surface area is 65.5 Å2.
How many rotatable bonds are there in 5,7-Dichloroquinoline-2,3-dicarboxylic acid diethyl ester?
There are 6 rotatable bonds.
What is the XLogP3-AA value for 5,7-Dichloroquinoline-2,3-dicarboxylic acid diethyl ester?
The XLogP3-AA value is 4.2.
How many hydrogen bond acceptor counts are there in 5,7-Dichloroquinoline-2,3-dicarboxylic acid diethyl ester?
There are 5 hydrogen bond acceptors.
Is 5,7-Dichloroquinoline-2,3-dicarboxylic acid diethyl ester a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound.