What is the molecular formula of 5,7-Dichloro-2-methylquinoline-3-carboxylic acid ethyl ester?
The molecular formula is C13H11Cl2NO2.
What is the molecular weight of 5,7-Dichloro-2-methylquinoline-3-carboxylic acid ethyl ester?
The molecular weight is 284.13 g/mol.
When was 5,7-Dichloro-2-methylquinoline-3-carboxylic acid ethyl ester created in PubChem?
It was created on 2007-11-13.
When was 5,7-Dichloro-2-methylquinoline-3-carboxylic acid ethyl ester last modified in PubChem?
It was last modified on 2023-12-30.
What is the IUPAC name of 5,7-Dichloro-2-methylquinoline-3-carboxylic acid ethyl ester?
The IUPAC name is ethyl 5,7-dichloro-2-methylquinoline-3-carboxylate.
What is the InChI of 5,7-Dichloro-2-methylquinoline-3-carboxylic acid ethyl ester?
The InChI is InChI=1S/C13H11Cl2NO2/c1-3-18-13(17)9-6-10-11(15)4-8(14)5-12(10)16-7(9)2/h4-6H,3H2,1-2H3.
What is the InChIKey of 5,7-Dichloro-2-methylquinoline-3-carboxylic acid ethyl ester?
The InChIKey is AYUXKFCXXXXIAD-UHFFFAOYSA-N.
What is the canonical SMILES of 5,7-Dichloro-2-methylquinoline-3-carboxylic acid ethyl ester?
The canonical SMILES is CCOC(=O)C1=C(N=C2C=C(C=C(C2=C1)Cl)Cl)C.
How many hydrogen bond acceptor counts does 5,7-Dichloro-2-methylquinoline-3-carboxylic acid ethyl ester have?
It has 3 hydrogen bond acceptor counts.
Is 5,7-Dichloro-2-methylquinoline-3-carboxylic acid ethyl ester a canonicalized compound?
Yes, it is a canonicalized compound.