What is the molecular formula of 5,7-Dichloro-4-hydroxyquinoline-3-carboxylic acid?
The molecular formula is C10H5Cl2NO3.
What is the molecular weight of 5,7-Dichloro-4-hydroxyquinoline-3-carboxylic acid?
The molecular weight is 258.05 g/mol.
What are the synonyms of 5,7-Dichloro-4-hydroxyquinoline-3-carboxylic acid?
Some synonyms include 5,7-dichloro-4-oxo-1H-quinoline-3-carboxylic acid and 3-Quinolinecarboxylic acid, 5,7-dichloro-4-hydroxy-.
What is the InChIKey of 5,7-Dichloro-4-hydroxyquinoline-3-carboxylic acid?
The InChIKey is DEBOCPZCSPMQBS-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 5,7-Dichloro-4-hydroxyquinoline-3-carboxylic acid?
The Canonical SMILES is C1=C(C=C(C2=C1NC=C(C2=O)C(=O)O)Cl)Cl.
How many hydrogen bond donor counts does 5,7-Dichloro-4-hydroxyquinoline-3-carboxylic acid have?
It has 2 hydrogen bond donor counts.
What is the topological polar surface area of 5,7-Dichloro-4-hydroxyquinoline-3-carboxylic acid?
The topological polar surface area is 66.4 Ų.
How many rotatable bond counts does 5,7-Dichloro-4-hydroxyquinoline-3-carboxylic acid have?
It has 1 rotatable bond count.
What is the XLogP3-AA value of 5,7-Dichloro-4-hydroxyquinoline-3-carboxylic acid?
The XLogP3-AA value is 3.1.
Is 5,7-Dichloro-4-hydroxyquinoline-3-carboxylic acid a chiral molecule?
No, it has 0 defined atom stereocenter counts.