What is the molecular formula of methyl 1-(2-furylmethyl)pyrrolidine-2-carboxylate?
The molecular formula is C11H15NO3.
When was methyl 1-(2-furylmethyl)pyrrolidine-2-carboxylate created and modified in PubChem?
It was created on 2009-07-21 and modified on 2023-12-30.
What is the IUPAC Name of methyl 1-(2-furylmethyl)pyrrolidine-2-carboxylate?
The IUPAC Name is methyl 1-(furan-2-ylmethyl)pyrrolidine-2-carboxylate.
What is the InChIKey of methyl 1-(2-furylmethyl)pyrrolidine-2-carboxylate?
The InChIKey is SDPWLPVYRUPJTL-UHFFFAOYSA-N.
What is the Canonical SMILES of methyl 1-(2-furylmethyl)pyrrolidine-2-carboxylate?
The Canonical SMILES is COC(=O)C1CCCN1CC2=CC=CO2.
What is the molecular weight of methyl 1-(2-furylmethyl)pyrrolidine-2-carboxylate?
The molecular weight is 209.24 g/mol.
What is the XLogP3-AA value of methyl 1-(2-furylmethyl)pyrrolidine-2-carboxylate?
The XLogP3-AA value is 1.3.
How many hydrogen bond acceptor counts does methyl 1-(2-furylmethyl)pyrrolidine-2-carboxylate have?
It has 4 hydrogen bond acceptor counts.
What is the exact mass and monoisotopic mass of methyl 1-(2-furylmethyl)pyrrolidine-2-carboxylate?
The exact mass and monoisotopic mass are both 209.10519334 g/mol.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.