What is the molecular formula of Pentafluorophenyl 2-pyrrolidin-1-ylpyrimidine-5-carboxylate?
The molecular formula is C15H10F5N3O2.
What is the molecular weight of Pentafluorophenyl 2-pyrrolidin-1-ylpyrimidine-5-carboxylate?
The molecular weight is 359.25 g/mol.
What is the IUPAC name of Pentafluorophenyl 2-pyrrolidin-1-ylpyrimidine-5-carboxylate?
The IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-pyrrolidin-1-ylpyrimidine-5-carboxylate.
What is the InChI of Pentafluorophenyl 2-pyrrolidin-1-ylpyrimidine-5-carboxylate?
The InChI is InChI=1S/C15H10F5N3O2/c16-8-9(17)11(19)13(12(20)10(8)18)25-14(24)7-5-21-15(22-6-7)23-3-1-2-4-23/h5-6H,1-4H2.
What is the InChIKey of Pentafluorophenyl 2-pyrrolidin-1-ylpyrimidine-5-carboxylate?
The InChIKey is YXDSLCBLWCPTJQ-UHFFFAOYSA-N.
How many hydrogen bond acceptors does Pentafluorophenyl 2-pyrrolidin-1-ylpyrimidine-5-carboxylate have?
It has 10 hydrogen bond acceptors.
What is the XLogP3-AA value of Pentafluorophenyl 2-pyrrolidin-1-ylpyrimidine-5-carboxylate?
The XLogP3-AA value is 3.1.
What is the topological polar surface area of Pentafluorophenyl 2-pyrrolidin-1-ylpyrimidine-5-carboxylate?
The topological polar surface area is 55.3 Ų.
How many heavy atoms are present in Pentafluorophenyl 2-pyrrolidin-1-ylpyrimidine-5-carboxylate?
There are 25 heavy atoms.
Is Pentafluorophenyl 2-pyrrolidin-1-ylpyrimidine-5-carboxylate a canonicalized compound?
Yes, the compound is canonicalized.