946409-40-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H10N2O2S.
The molecular weight of the compound is 198.24 g/mol.
The IUPAC name of the compound is methyl 2-(6-methylsulfanylpyrimidin-4-yl)acetate.
The InChI of the compound is InChI=1S/C8H10N2O2S/c1-12-8(11)4-6-3-7(13-2)10-5-9-6/h3,5H,4H2,1-2H3.
The InChIKey of the compound is DRTJHLOLUHCUSC-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC(=O)CC1=CC(=NC=N1)SC.
The CAS number of the compound is 946422-10-2.
The XLogP3-AA value of the compound is 0.9.
The compound has 0 hydrogen bond donor count.
The compound has 5 hydrogen bond acceptor count.