944580-73-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C9H7F3N2.
The synonyms of the compound are 944580-76-1, PROP-2-YNYL-(6-TRIFLUOROMETHYL-PYRIDIN-2-YL)-AMINE, DTXSID10669566, AKOS011420900, and N-(Prop-2-yn-1-yl)-6-(trifluoromethyl)pyridin-2-amine.
The molecular weight of the compound is 200.16 g/mol.
The IUPAC name of the compound is N-prop-2-ynyl-6-(trifluoromethyl)pyridine-2-amine.
The InChI code of the compound is InChI=1S/C9H7F3N2/c1-2-6-13-8-5-3-4-7(14-8)9(10,11)12/h1,3-5H,6H2,(H,13,14).
The InChIKey of the compound is JAMWFFWOAYQADA-UHFFFAOYSA-N.
The canonical SMILES of the compound is C#CCNC1=CC=CC(=N1)C(F)(F)F.
The CAS number of the compound is 944580-76-1.
The XLogP3-AA value of the compound is 2.2.
Yes, the compound is canonicalized.