944580-74-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H7F3N2.
The IUPAC Name of the compound is N-prop-2-ynyl-4-(trifluoromethyl)pyridin-2-amine.
The InChI of the compound is InChI=1S/C9H7F3N2/c1-2-4-13-8-6-7(3-5-14-8)9(10,11)12/h1,3,5-6H,4H2,(H,13,14).
The InChIKey of the compound is WWBMUFRFOKDOPX-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C#CCNC1=NC=CC(=C1)C(F)(F)F.
The molecular weight of the compound is 200.16 g/mol.
The XLogP3-AA value of the compound is 2.2.
The compound has 1 hydrogen bond donor count.
The compound has 5 hydrogen bond acceptor counts.
The compound has 2 rotatable bond counts.