What is the molecular formula of Allyl-(6-trifluoromethyl-pyridin-2-yl)-amine?
The molecular formula is C9H9F3N2.
What is the molecular weight of Allyl-(6-trifluoromethyl-pyridin-2-yl)-amine?
The molecular weight is 202.18 g/mol.
What is the IUPAC name of Allyl-(6-trifluoromethyl-pyridin-2-yl)-amine?
The IUPAC name is N-prop-2-enyl-6-(trifluoromethyl)pyridin-2-amine.
What is the InChI of Allyl-(6-trifluoromethyl-pyridin-2-yl)-amine?
The InChI is InChI=1S/C9H9F3N2/c1-2-6-13-8-5-3-4-7(14-8)9(10,11)12/h2-5H,1,6H2,(H,13,14).
What is the InChIKey of Allyl-(6-trifluoromethyl-pyridin-2-yl)-amine?
The InChIKey is IFXRFUMNSMOLRR-UHFFFAOYSA-N.
What is the Canonical SMILES of Allyl-(6-trifluoromethyl-pyridin-2-yl)-amine?
The Canonical SMILES is C=CCNC1=CC=CC(=N1)C(F)(F)F.
What is the CAS number of Allyl-(6-trifluoromethyl-pyridin-2-yl)-amine?
The CAS number is 944580-75-0.
What is the XLogP3-AA value of Allyl-(6-trifluoromethyl-pyridin-2-yl)-amine?
The XLogP3-AA value is 2.7.
How many hydrogen bond donor counts does Allyl-(6-trifluoromethyl-pyridin-2-yl)-amine have?
It has 1 hydrogen bond donor count.
How many rotatable bond counts does Allyl-(6-trifluoromethyl-pyridin-2-yl)-amine have?
It has 3 rotatable bond counts.