93552-74-0 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C10H8BrFN4O.
The molecular weight of the compound is 299.10 g/mol.
The IUPAC name of the compound is 5-(2-bromo-5-fluorophenoxy)pyrimidine-2,4-diamine.
The InChI of the compound is InChI=1S/C10H8BrFN4O/c11-6-2-1-5(12)3-7(6)17-8-4-15-10(14)16-9(8)13/h1-4H,(H4,13,14,15,16).
The InChIKey of the compound is FMMIFFPYKIEWRV-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=C(C=C1F)OC2=CN=C(N=C2N)N)Br.
The XLogP3-AA value of the compound is 1.8.
The compound has 2 hydrogen bond donor counts.
The compound has 6 hydrogen bond acceptor counts.
The compound has 2 rotatable bond counts.