What is the molecular formula of (7-Methoxy-chroman-3-yl)-carbamic acid tert-butyl ester?
The molecular formula is C15H21NO4.
What are the synonyms for (7-Methoxy-chroman-3-yl)-carbamic acid tert-butyl ester?
The synonyms are 935534-24-0 and 1,1-Dimethylethyl N-(3,4-dihydro-7-methoxy-2H-1-benzopyran-3-yl)carbamate.
What is the molecular weight of (7-Methoxy-chroman-3-yl)-carbamic acid tert-butyl ester?
The molecular weight is 279.33 g/mol.
When was (7-Methoxy-chroman-3-yl)-carbamic acid tert-butyl ester created?
It was created on February 16, 2015.
When was (7-Methoxy-chroman-3-yl)-carbamic acid tert-butyl ester last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of (7-Methoxy-chroman-3-yl)-carbamic acid tert-butyl ester?
The IUPAC name is tert-butyl N-(7-methoxy-3,4-dihydro-2H-chromen-3-yl)carbamate.
What is the InChI code for (7-Methoxy-chroman-3-yl)-carbamic acid tert-butyl ester?
The InChI code is InChI=1S/C15H21NO4/c1-15(2,3)20-14(17)16-11-7-10-5-6-12(18-4)8-13(10)19-9-11/h5-6,8,11H,7,9H2,1-4H3,(H,16,17).
What is the Canonical SMILES code for (7-Methoxy-chroman-3-yl)-carbamic acid tert-butyl ester?
The Canonical SMILES code is CC(C)(C)OC(=O)NC1CC2=C(C=C(C=C2)OC)OC1.
What is the XLogP3-AA value of (7-Methoxy-chroman-3-yl)-carbamic acid tert-butyl ester?
The XLogP3-AA value is 2.7.
Is (7-Methoxy-chroman-3-yl)-carbamic acid tert-butyl ester considered canonical?
Yes, it is considered canonical.