CAS
926249-10-7 Purity
96%
926249-10-7 Purity
96%
Inquiry Basket
2-Ammonio-1-methylethyl sulfate
CAS
926-25-0
Catalog Number
ACM926250
Category
Other Products
Molecular Formula
C3H9NO4S
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-azaniumylpropan-2-yl sulfate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C3H9NO4S/c1-3(2-4)8-9(5,6)7/h3H,2,4H2,1H3,(H,5,6,7).
What is the InChIKey of the compound?
The InChIKey of the compound is FUJGHFAISHTYGC-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CC(C[NH3+])OS(=O)(=O)[O-].
What is the molecular weight of the compound?
The molecular weight of the compound is 155.18 g/mol.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is -3.7.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 2 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![2-[(Cyclopropylcarbonyl)amino]-3-methylbenzoic acid](https://resource.alfa-chemistry.com/structure/926249-10-7.gif)
