926248-15-9 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound associated with the keyword is C12H18N2O.
The compound associated with the keyword was created in PubChem on November 13, 2007.
The molecular weight of the compound associated with the keyword is 206.28 g/mol.
The IUPAC Name of the compound associated with the keyword is 4-amino-3-methyl-N-(2-methylpropyl)benzamide.
The Canonical SMILES of the compound associated with the keyword is CC1=C(C=CC(=C1)C(=O)NCC(C)C)N.
There are 2 hydrogen bond donor counts in the compound associated with the keyword.
The XLogP3-AA value of the compound associated with the keyword is 2.2.
The exact mass of the compound associated with the keyword is 206.141913202 g/mol.
Yes, the compound associated with the keyword is Canonicalized.
There are 3 rotatable bond counts in the compound associated with the keyword.