CAS
925233-08-5 Purity
---
925233-08-5 Purity
---
Inquiry Basket
2-Pyrrolidinol,1-(2-chloro-3-hydroxyphenyl)-
CAS
925233-21-2
Catalog Number
ACM925233212
Category
Other Products
Molecular Formula
C10H12ClNO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound with PubChem CID 68447282?
The molecular formula is C10H12ClNO2.
What are some synonyms of the compound?
Some synonyms include 1-(2-CHLORO-3-HYDROXYPHENYL)PYRROLIDIN-2-OL and SCHEMBL2934910.
What is the molecular weight of the compound?
The molecular weight is 213.66 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is 1-(2-chloro-3-hydroxyphenyl)pyrrolidin-2-ol.
What is the Canonical SMILES of the compound?
The Canonical SMILES is C1CC(N(C1)C2=C(C(=CC=C2)O)Cl)O.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donors.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptors.
What is the XLogP3-AA property value of the compound?
The XLogP3-AA property value is 2.3.
What is the topological polar surface area of the compound?
The topological polar surface area is 43.7 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
CAS
925233-20-1 Purity
---
925233-20-1 Purity
---
![Phenol,2-chloro-3-[2-(methoxymethyl)-1-pyrrolidinyl]-](https://resource.alfa-chemistry.com/structure/925233-23-4.gif)
CAS
925233-24-5 Purity
---
925233-24-5 Purity
---
