CAS
92521-18-1 Purity
---
92521-18-1 Purity
---
Inquiry Basket
Proline,1-(2-chloro-3-hydroxyphenyl)-
CAS
925233-19-8
Catalog Number
ACM925233198
Category
Other Products
Molecular Formula
C11H12ClNO3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the PubChem CID of the compound?
The PubChem CID of the compound is 77230470.
What is the molecular formula of the compound?
The molecular formula of the compound is C11H12ClNO3.
What are the synonyms of the compound?
The synonyms of the compound are "1-(2-chloro-3-hydroxyphenyl)Proline" and "Proline,1-(2-chloro-3-hydroxyphenyl)-".
What is the molecular weight of the compound?
The molecular weight of the compound is 241.67 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (2S)-1-(2-chloro-3-hydroxyphenyl)pyrrolidine-2-carboxylic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H12ClNO3/c12-10-7(3-1-5-9(10)14)13-6-2-4-8(13)11(15)16/h1,3,5,8,14H,2,4,6H2,(H,15,16)/t8-/m0/s1.
What is the InChIKey of the compound?
The InChIKey of the compound is VBZHENWFVMPLLB-QMMMGPOBSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1CC(N(C1)C2=C(C(=CC=C2)O)Cl)C(=O)O.
What is the isomeric SMILES of the compound?
The isomeric SMILES of the compound is C1C[C@H](N(C1)C2=C(C(=CC=C2)O)Cl)C(=O)O.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
CAS
925233-20-1 Purity
---
925233-20-1 Purity
---
