What is the molecular formula of phenol,2-chloro-3-(1-pyrrolidinyl)?
The molecular formula is C10H12ClNO.
What is the molecular weight of phenol,2-chloro-3-(1-pyrrolidinyl)?
The molecular weight is 197.66 g/mol.
What is the IUPAC name of phenol,2-chloro-3-(1-pyrrolidinyl)?
The IUPAC name is 2-chloro-3-pyrrolidin-1-ylphenol.
What is the InChI of phenol,2-chloro-3-(1-pyrrolidinyl)?
The InChI is InChI=1S/C10H12ClNO/c11-10-8(4-3-5-9(10)13)12-6-1-2-7-12/h3-5,13H,1-2,6-7H2.
What is the InChIKey of phenol,2-chloro-3-(1-pyrrolidinyl)?
The InChIKey is XNXYBHMFUZGAJL-UHFFFAOYSA-N.
What is the canonical SMILES of phenol,2-chloro-3-(1-pyrrolidinyl)?
The canonical SMILES is C1CCN(C1)C2=C(C(=CC=C2)O)Cl.
What is the XLogP3-AA value of phenol,2-chloro-3-(1-pyrrolidinyl)?
The XLogP3-AA value is 2.8.
How many hydrogen bond donor counts does phenol,2-chloro-3-(1-pyrrolidinyl) have?
It has one hydrogen bond donor count.
How many hydrogen bond acceptor counts does phenol,2-chloro-3-(1-pyrrolidinyl) have?
It has two hydrogen bond acceptor counts.
What is the topological polar surface area of phenol,2-chloro-3-(1-pyrrolidinyl)?
The topological polar surface area is 23.5 ?2.