What is the molecular formula of 5-Bromo-2-(2-carboxybenzamido)benzoic acid?
The molecular formula is C15H10BrNO5.
When was 5-Bromo-2-(2-carboxybenzamido)benzoic acid created and last modified in the database?
It was created on 2009-05-28 and last modified on 2023-12-30.
What is the IUPAC Name of 5-Bromo-2-(2-carboxybenzamido)benzoic acid?
The IUPAC Name is 5-bromo-2-[(2-carboxybenzoyl)amino]benzoic acid.
What is the InChI of 5-Bromo-2-(2-carboxybenzamido)benzoic acid?
The InChI is InChI=1S/C15H10BrNO5/c16-8-5-6-12(11(7-8)15(21)22)17-13(18)9-3-1-2-4-10(9)14(19)20/h1-7H,(H,17,18)(H,19,20)(H,21,22).
What is the InChIKey of 5-Bromo-2-(2-carboxybenzamido)benzoic acid?
The InChIKey is CZHNRPOPMADPAK-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 5-Bromo-2-(2-carboxybenzamido)benzoic acid have?
It has 3 hydrogen bond donor counts.
What is the topological polar surface area of 5-Bromo-2-(2-carboxybenzamido)benzoic acid?
The topological polar surface area is 104 Å^2.
What is the XLogP3-AA value of 5-Bromo-2-(2-carboxybenzamido)benzoic acid?
The XLogP3-AA value is 3.1.
How many rotatable bond counts does 5-Bromo-2-(2-carboxybenzamido)benzoic acid have?
It has 4 rotatable bond counts.
Is 5-Bromo-2-(2-carboxybenzamido)benzoic acid a canonicalized compound?
Yes, the compound is canonicalized.