What is the molecular formula of Hydrazinecarboxylicacid,2-(4-nitrophenyl)-,1,1-dimethylethyl ester?
The molecular formula is C11H15N3O4.
What are some synonyms for Hydrazinecarboxylicacid,2-(4-nitrophenyl)-,1,1-dimethylethyl ester?
Some synonyms include TERT-BUTYL 2-(4-NITROPHENYL)HYDRAZINECARBOXYLATE, O-tert-Butyl-N-4-nitrophenyl carbazate, and tert-butyl N-(4-nitroanilino)carbamate.
When was Hydrazinecarboxylicacid,2-(4-nitrophenyl)-,1,1-dimethylethyl ester first created in PubChem?
It was first created on December 5, 2007.
What is the molecular weight of Hydrazinecarboxylicacid,2-(4-nitrophenyl)-,1,1-dimethylethyl ester?
The molecular weight is 253.25 g/mol.
What is the InChIKey for Hydrazinecarboxylicacid,2-(4-nitrophenyl)-,1,1-dimethylethyl ester?
The InChIKey is JGHNMFQIFLJPRR-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Hydrazinecarboxylicacid,2-(4-nitrophenyl)-,1,1-dimethylethyl ester?
The Canonical SMILES is CC(C)(C)OC(=O)NNC1=CC=C(C=C1)[N+](=O)[O-].
How many hydrogen bond donor counts does Hydrazinecarboxylicacid,2-(4-nitrophenyl)-,1,1-dimethylethyl ester have?
It has 2 hydrogen bond donor counts.
What is the topological polar surface area of Hydrazinecarboxylicacid,2-(4-nitrophenyl)-,1,1-dimethylethyl ester?
The topological polar surface area is 96.2 Ų.
Does Hydrazinecarboxylicacid,2-(4-nitrophenyl)-,1,1-dimethylethyl ester have any defined atom stereocenter counts?
No, it does not have any defined atom stereocenter counts.
Is the compound canonicalized in PubChem for Hydrazinecarboxylicacid,2-(4-nitrophenyl)-,1,1-dimethylethyl ester?
Yes, the compound is canonicalized in PubChem.