CAS
924887-08-1 Purity
---
924887-08-1 Purity
---
Inquiry Basket
5,6-Dimethyl-4-oxo-pyran-2-carboxylate
CAS
92490-75-0
Catalog Number
ACM92490750
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5,6-dimethyl-4-oxo-4H-pyran-2-carboxylic acid?
The molecular formula is C8H8O4.
When was 5,6-dimethyl-4-oxo-4H-pyran-2-carboxylic acid created according to PubChem?
It was created on 2005-07-19.
What is the molecular weight of 5,6-dimethyl-4-oxo-4H-pyran-2-carboxylic acid?
The molecular weight is 168.15 g/mol.
How many hydrogen bond donor counts does 5,6-dimethyl-4-oxo-4H-pyran-2-carboxylic acid have?
It has 1 hydrogen bond donor count.
What is the Canonical SMILES of 5,6-dimethyl-4-oxo-4H-pyran-2-carboxylic acid?
The Canonical SMILES is CC1=C(OC(=CC1=O)C(=O)O)C.
How many hydrogen bond acceptor counts does 5,6-dimethyl-4-oxo-4H-pyran-2-carboxylic acid have?
It has 4 hydrogen bond acceptor counts.
What is the XLogP3-AA value of 5,6-dimethyl-4-oxo-4H-pyran-2-carboxylic acid?
The XLogP3-AA value is 0.6.
What is the exact mass of 5,6-dimethyl-4-oxo-4H-pyran-2-carboxylic acid?
The exact mass is 168.04225873 g/mol.
Is 5,6-dimethyl-4-oxo-4H-pyran-2-carboxylic acid a canonicalized compound?
Yes, it is a canonicalized compound.
What is the Topological Polar Surface Area of 5,6-dimethyl-4-oxo-4H-pyran-2-carboxylic acid?
The Topological Polar Surface Area is 63.6 ?2.
Recommended Products
![Benzoic acid, 4-[(1S)-1-hydrazinylethyl]-](https://resource.alfa-chemistry.com/structure/924887-08-1.gif)
![(R)-1-Boc-2-[(2-fluoro-phenylamino)-methyl]-pyrrolidine](https://resource.alfa-chemistry.com/structure/924907-26-6.gif)
CAS
924907-26-6 Purity
---
924907-26-6 Purity
---
CAS
92491-67-3 Purity
96%
92491-67-3 Purity
96%
