923009-50-1 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular weight of Pyrido[2,3-c]-1,5-naphthyridine,7,8,9,10-tetrahydro is 185.22 g/mol.
The IUPAC name of the compound is 7,8,9,10-tetrahydropyrido[2,3-c][1,5]naphthyridine.
The InChI of the compound is InChI=1S/C11H11N3/c1-3-8-10(12-5-1)7-14-9-4-2-6-13-11(8)9/h2,4,6-7,12H,1,3,5H2.
The InChIKey of the compound is GLLZBUARIYKPSA-UHFFFAOYSA-N.
The canonical SMILES representation of the compound is C1CC2=C3C(=NC=C2NC1)C=CC=N3.
The CAS number of the compound is 923012-55-9.
The molecular formula of the compound is C11H11N3.
The XLogP3-AA value of the compound is 1.6.
The compound has 1 hydrogen bond donor count.
The topological polar surface area of the compound is 37.8 Å2.