What is the molecular formula of tert-Butyl 5-oxo-4,10-diazaspiro[5.5]undecane-10-carboxylate?
The molecular formula is C14H24N2O3.
What is the molecular weight of tert-Butyl 5-oxo-4,10-diazaspiro[5.5]undecane-10-carboxylate?
The molecular weight is 268.35 g/mol.
What is the IUPAC Name of tert-Butyl 5-oxo-4,10-diazaspiro[5.5]undecane-10-carboxylate?
The IUPAC Name is tert-butyl 1-oxo-2,8-diazaspiro[5.5]undecane-8-carboxylate.
What is the InChI of tert-Butyl 5-oxo-4,10-diazaspiro[5.5]undecane-10-carboxylate?
The InChI is InChI=1S/C14H24N2O3/c1-13(2,3)19-12(18)16-9-5-7-14(10-16)6-4-8-15-11(14)17/h4-10H2,1-3H3,(H,15,17).
What is the InChIKey of tert-Butyl 5-oxo-4,10-diazaspiro[5.5]undecane-10-carboxylate?
The InChIKey is BCWUGEIFXRKYMP-UHFFFAOYSA-N.
What is the Canonical SMILES of tert-Butyl 5-oxo-4,10-diazaspiro[5.5]undecane-10-carboxylate?
The Canonical SMILES is CC(C)(C)OC(=O)N1CCCC2(C1)CCCNC2=O.
What is the XLogP3-AA value of tert-Butyl 5-oxo-4,10-diazaspiro[5.5]undecane-10-carboxylate?
The XLogP3-AA value is 1.2.
How many hydrogen bond donor counts does tert-Butyl 5-oxo-4,10-diazaspiro[5.5]undecane-10-carboxylate have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of tert-Butyl 5-oxo-4,10-diazaspiro[5.5]undecane-10-carboxylate?
The topological polar surface area is 58.6 Ų.
Is tert-Butyl 5-oxo-4,10-diazaspiro[5.5]undecane-10-carboxylate a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound.