What is the molecular formula of 4-Amino-6,8-dichloro-2-methylquinoline?
The molecular formula is C10H8Cl2N2.
When was 4-Amino-6,8-dichloro-2-methylquinoline created?
It was created on November 13, 2007.
What is the molecular weight of 4-Amino-6,8-dichloro-2-methylquinoline?
The molecular weight is 227.09 g/mol.
What is the IUPAC name of 4-Amino-6,8-dichloro-2-methylquinoline?
The IUPAC name is 6,8-dichloro-2-methylquinolin-4-amine.
What is the InChI of 4-Amino-6,8-dichloro-2-methylquinoline?
The InChI is InChI=1S/C10H8Cl2N2/c1-5-2-9(13)7-3-6(11)4-8(12)10(7)14-5/h2-4H,1H3,(H2,13,14).
What is the Canonical SMILES of 4-Amino-6,8-dichloro-2-methylquinoline?
The Canonical SMILES is CC1=CC(=C2C=C(C=C(C2=N1)Cl)Cl)N.
How many heavy atoms are present in 4-Amino-6,8-dichloro-2-methylquinoline?
There are 14 heavy atoms.
What is the topological polar surface area of 4-Amino-6,8-dichloro-2-methylquinoline?
The topological polar surface area is 38.9 Ų.
Is 4-Amino-6,8-dichloro-2-methylquinoline canonicalized as a compound?
Yes, it is canonicalized as a compound.
What is the XLogP3-AA value of 4-Amino-6,8-dichloro-2-methylquinoline?
The XLogP3-AA value is 3.2.