CAS
917483-72-8 Purity
---
917483-72-8 Purity
---
Inquiry Basket
3,4-Dihydroxybenzoic acid monopotassium salt
CAS
91753-30-9
Catalog Number
ACM91753309
Category
Other Products
Molecular Weight
192.21
Molecular Formula
C7H5KO4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
3,4-Dihydroxybenzoic acid,Monopotassium salt
What is the PubChem CID for 3,4-Dihydroxybenzoic acid monopotassium salt?
The PubChem CID for 3,4-Dihydroxybenzoic acid monopotassium salt is 45108174.
What is the molecular formula of 3,4-Dihydroxybenzoic acid monopotassium salt?
The molecular formula of 3,4-Dihydroxybenzoic acid monopotassium salt is C7H5KO4.
What is the molecular weight of 3,4-Dihydroxybenzoic acid monopotassium salt?
The molecular weight of 3,4-Dihydroxybenzoic acid monopotassium salt is 192.21 g/mol.
What is the IUPAC name of 3,4-Dihydroxybenzoic acid monopotassium salt?
The IUPAC name of 3,4-Dihydroxybenzoic acid monopotassium salt is potassium;3,4-dihydroxybenzoate.
What is the InChI of 3,4-Dihydroxybenzoic acid monopotassium salt?
The InChI of 3,4-Dihydroxybenzoic acid monopotassium salt is InChI=1S/C7H6O4.K/c8-5-2-1-4(7(10)11)3-6(5)9;/h1-3,8-9H,(H,10,11);/q;+1/p-1.
What is the canonical SMILES of 3,4-Dihydroxybenzoic acid monopotassium salt?
The canonical SMILES of 3,4-Dihydroxybenzoic acid monopotassium salt is C1=CC(=C(C=C1C(=O)[O-])O)O.[K+].
What is the CAS number of 3,4-Dihydroxybenzoic acid monopotassium salt?
The CAS number of 3,4-Dihydroxybenzoic acid monopotassium salt is 91753-30-9.
What is the hydrogen bond donor count of 3,4-Dihydroxybenzoic acid monopotassium salt?
The hydrogen bond donor count of 3,4-Dihydroxybenzoic acid monopotassium salt is 2.
What is the hydrogen bond acceptor count of 3,4-Dihydroxybenzoic acid monopotassium salt?
The hydrogen bond acceptor count of 3,4-Dihydroxybenzoic acid monopotassium salt is 4.
What is the topological polar surface area of 3,4-Dihydroxybenzoic acid monopotassium salt?
The topological polar surface area of 3,4-Dihydroxybenzoic acid monopotassium salt is 80.6 Ų.
Recommended Products
![2,2,2-Trifluoro-1-[1-(4-fluorophenyl)-1H-indazol-5-yl]ethanone](https://resource.alfa-chemistry.com/structure/917494-85-0.gif)
CAS
917494-85-0 Purity
96%
917494-85-0 Purity
96%
