What is the molecular formula of 4-Amino-7,8-dichloro-2-methylquinoline?
The molecular formula is C10H8Cl2N2.
When was 4-Amino-7,8-dichloro-2-methylquinoline created and modified?
It was created on 2007-11-13 and modified on 2023-12-30.
What is the IUPAC name of 4-Amino-7,8-dichloro-2-methylquinoline?
The IUPAC name is 7,8-dichloro-2-methylquinolin-4-amine.
What is the molecular weight of 4-Amino-7,8-dichloro-2-methylquinoline?
The molecular weight is 227.09 g/mol.
What is the InChI of 4-Amino-7,8-dichloro-2-methylquinoline?
The InChI is InChI=1S/C10H8Cl2N2/c1-5-4-8(13)6-2-3-7(11)9(12)10(6)14-5/h2-4H,1H3,(H2,13,14).
What is the Canonical SMILES of 4-Amino-7,8-dichloro-2-methylquinoline?
The Canonical SMILES is CC1=CC(=C2C=CC(=C(C2=N1)Cl)Cl)N.
How many hydrogen bond donor counts does 4-Amino-7,8-dichloro-2-methylquinoline have?
It has 1 hydrogen bond donor count.
What is the XLogP3-AA value of 4-Amino-7,8-dichloro-2-methylquinoline?
The XLogP3-AA value is 3.2.
How many rotatable bond counts does 4-Amino-7,8-dichloro-2-methylquinoline have?
It has 0 rotatable bond counts.
Is 4-Amino-7,8-dichloro-2-methylquinoline considered to be a canonicalized compound?
Yes, it is considered to be a canonicalized compound.