What is the molecular formula of (S)-3-Azido-2-(3-chlorobenzyl)propanamide?
The molecular formula is C10H11ClN4O.
What is the molecular weight of (S)-3-Azido-2-(3-chlorobenzyl)propanamide?
The molecular weight is 238.67 g/mol.
What is the IUPAC name of (S)-3-Azido-2-(3-chlorobenzyl)propanamide?
The IUPAC name is (2S)-2-(azidomethyl)-3-(3-chlorophenyl)propanamide.
What is the InChI of (S)-3-Azido-2-(3-chlorobenzyl)propanamide?
The InChI is InChI=1S/C10H11ClN4O/c11-9-3-1-2-7(5-9)4-8(10(12)16)6-14-15-13/h1-3,5,8H,4,6H2,(H2,12,16)/t8-/m0/s1.
What is the InChIKey of (S)-3-Azido-2-(3-chlorobenzyl)propanamide?
The InChIKey is ZHGWAGGISPKMJN-QMMMGPOBSA-N.
What is the canonical SMILES of (S)-3-Azido-2-(3-chlorobenzyl)propanamide?
The canonical SMILES is C1=CC(=CC(=C1)Cl)CC(CN=[N+]=[N-])C(=O)N.
How many hydrogen bond donor count does (S)-3-Azido-2-(3-chlorobenzyl)propanamide have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does (S)-3-Azido-2-(3-chlorobenzyl)propanamide have?
It has 3 hydrogen bond acceptor count.
What is the topological polar surface area of (S)-3-Azido-2-(3-chlorobenzyl)propanamide?
The topological polar surface area is 57.4 ?2.
Is (S)-3-Azido-2-(3-chlorobenzyl)propanamide a canonicalized compound?
Yes, it is a canonicalized compound.