What is the molecular formula of (S)-3-Azido-2-(4-methoxybenzyl)propanamide?
The molecular formula is C11H14N4O2.
What is the molecular weight of (S)-3-Azido-2-(4-methoxybenzyl)propanamide?
The molecular weight is 234.25 g/mol.
What is the IUPAC name of (S)-3-Azido-2-(4-methoxybenzyl)propanamide?
The IUPAC name is (2S)-2-(azidomethyl)-3-(4-methoxyphenyl)propanamide.
What is the InChI of (S)-3-Azido-2-(4-methoxybenzyl)propanamide?
The InChI is InChI=1S/C11H14N4O2/c1-17-10-4-2-8(3-5-10)6-9(11(12)16)7-14-15-13/h2-5,9H,6-7H2,1H3,(H2,12,16)/t9-/m0/s1.
What is the InChIKey of (S)-3-Azido-2-(4-methoxybenzyl)propanamide?
The InChIKey is FLBVSSHFKSPCLT-VIFPVBQESA-N.
What is the canonical SMILES of (S)-3-Azido-2-(4-methoxybenzyl)propanamide?
The canonical SMILES is COC1=CC=C(C=C1)CC(CN=[N+]=[N-])C(=O)N.
What is the isomeric SMILES of (S)-3-Azido-2-(4-methoxybenzyl)propanamide?
The isomeric SMILES is COC1=CC=C(C=C1)C[C@@H](CN=[N+]=[N-])C(=O)N.
What is the XLogP3-AA value of (S)-3-Azido-2-(4-methoxybenzyl)propanamide?
The XLogP3-AA value is 1.9.
How many hydrogen bond donor counts does (S)-3-Azido-2-(4-methoxybenzyl)propanamide have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does (S)-3-Azido-2-(4-methoxybenzyl)propanamide have?
It has 4 hydrogen bond acceptor counts.