What is the molecular formula of (S)-3-Azido-2-(4-fluorobenzyl)propanamide?
The molecular formula is C10H11FN4O.
What is the molecular weight of (S)-3-Azido-2-(4-fluorobenzyl)propanamide?
The molecular weight is 222.22 g/mol.
What is the IUPAC name of (S)-3-Azido-2-(4-fluorobenzyl)propanamide?
The IUPAC name is (2S)-2-(azidomethyl)-3-(4-fluorophenyl)propanamide.
What is the InChI of (S)-3-Azido-2-(4-fluorobenzyl)propanamide?
The InChI is InChI=1S/C10H11FN4O/c11-9-3-1-7(2-4-9)5-8(10(12)16)6-14-15-13/h1-4,8H,5-6H2,(H2,12,16)/t8-/m0/s1.
What is the InChIKey of (S)-3-Azido-2-(4-fluorobenzyl)propanamide?
The InChIKey is YMOAZPMIORYMGP-QMMMGPOBSA-N.
What is the canonical SMILES of (S)-3-Azido-2-(4-fluorobenzyl)propanamide?
The canonical SMILES is C1=CC(=CC=C1CC(CN=[N+]=[N-])C(=O)N)F.
What is the isomeric SMILES of (S)-3-Azido-2-(4-fluorobenzyl)propanamide?
The isomeric SMILES is C1=CC(=CC=C1C[C@@H](CN=[N+]=[N-])C(=O)N)F.
What is the XLogP3-AA value of (S)-3-Azido-2-(4-fluorobenzyl)propanamide?
The XLogP3-AA value is 2.1.
How many hydrogen bond donor counts are there in (S)-3-Azido-2-(4-fluorobenzyl)propanamide?
There is 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts are there in (S)-3-Azido-2-(4-fluorobenzyl)propanamide?
There are 4 hydrogen bond acceptor counts.